loading...| Preferred Name |
|
|
| Synonyms |
N-(4-ethoxyphenyl)acetamide Phenacetin phenacetin Achrocidin Contradouleur Contradol Phenacetine Codempiral 4-Ethoxyacetanilide Acetophenetin Acetphenetidin Commotional Acetophenetidin Fenacetina Acetophenetidine 1-Acetamido-4-ethoxybenzene Phenacetinum |
|
| Definitions |
A member of the class of acetamides that is acetamide in which one of the hydrogens attached to the nitrogen is substituted by a 4-ethoxyphenyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8050 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:62-44-2 PDBeChem:N4E Wikipedia:Phenacetin KEGG:C07591 KEGG:D00569 LINCS:LSM-2851 DrugBank:DB03783 PMID:24447449 PMID:24201458 Drug_Central:2115 Patent:US2887513 Reaxys:1869238 |
|
| definition |
A member of the class of acetamides that is acetamide in which one of the hydrogens attached to the nitrogen is substituted by a 4-ethoxyphenyl group. |
|
| formula |
C10H13NO2 |
|
| has_exact_synonym |
N-(4-ethoxyphenyl)acetamide Phenacetin |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
phenacetin Achrocidin Contradouleur Contradol Phenacetine Codempiral 4-Ethoxyacetanilide Acetophenetin Acetphenetidin N-(4-ethoxyphenyl)acetamide Commotional Acetophenetidin Fenacetina Acetophenetidine 1-Acetamido-4-ethoxybenzene Phenacetinum |
|
| id |
CHEBI:8050 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H13NO2/c1-3-13-10-6-4-9(5-7-10)11-8(2)12/h4-7H,3H2,1-2H3,(H,11,12) |
|
| inchikey |
CPJSUEIXXCENMM-UHFFFAOYSA-N |
|
| label |
phenacetin |
|
| mass |
179.216 |
|
| monoisotopicmass |
179.09463 |
|
| notation |
CHEBI:8050 |
|
| smiles |
C=1C=C(OCC)C=CC1NC(C)=O |
|
| subClassOf |