Preferred Name |
|
|
Synonyms |
potassium dichromate(VI) dipotassium dichromate potassium dichromate(2-) Dichromic acid dipotassium salt Kaliumdichromat Chromium potassium oxide Dipotassium dichromium heptaoxide Potassium dichromate(VI) Dipotassium dichromate Dipotassium bichromate |
|
Definitions |
A potassium salt that is the dipotassium salt of dichromic acid. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_53444 |
|
charge |
0 |
|
database_cross_reference |
ChEMBL:897985 ChemIDplus:7778-50-9 CiteXplore:21616561 CiteXplore:7687268 CiteXplore:18837732 MeSH:D011192 NCIt:C45890 SNOMEDCT:411143006 CiteXplore:8566016 NIST Chemistry WebBook:7778-50-9 SNOMEDCT:19893005 PMID:17244079 PMID:18021598 PMID:14674893 PMID:29079364 PMID:21616561 CAS:7778-50-9 Wikipedia:Potassium_dichromate KEGG:C15227 PMID:7687268 PMID:15127151 PMID:23410589 PMID:18837732 PMID:15858473 PMID:14744416 PMID:8566016 |
|
definition |
A potassium salt that is the dipotassium salt of dichromic acid. |
|
formula |
Cr2K2O7 |
|
has_exact_synonym |
potassium dichromate(VI) dipotassium dichromate potassium dichromate(2-) |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Dichromic acid dipotassium salt Kaliumdichromat Chromium potassium oxide Dipotassium dichromium heptaoxide Potassium dichromate(VI) Dipotassium dichromate Dipotassium bichromate |
|
id |
CHEBI:53444 |
|
in_subset | ||
inchi |
InChI=1S/2Cr.2K.7O/q;;2*+1;;;;;;2*-1 |
|
inchikey |
KMUONIBRACKNSN-UHFFFAOYSA-N |
|
label |
potassium dichromate |
|
mass |
294.18460 |
|
monoisotopicmass |
293.77283 |
|
notation |
CHEBI:53444 |
|
smiles |
[K+].[K+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O |
|
subClassOf |