loading...| Preferred Name |
|
|
| Synonyms |
2,6-bis(propan-2-yl)phenol Propofol Disoprivan 2,6-bis(1-methylethyl)phenol 2,6-Diisopropylphenol propofol Disoprofol propofolum Diprivan 2,6-BIS(1-METHYLETHYL)PHENOL Rapinovet |
|
| Definitions |
A phenol resulting from the formal substitution of the hydrogen at the 2 position of 1,3-diisopropylbenzene by a hydroxy group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_44915 |
|
| charge |
0 |
|
| database_cross_reference |
SNOMEDCT:387423006 MeSH:D015742 SNOMEDCT:74674007 NCIt:C29384 PDBeChem:PFL KEGG:C07523 DrugBank:DB00818 Beilstein:1866484 KEGG:D00549 VSDB:1846 CAS:2078-54-8 Drug_Central:2302 Wikipedia:Propofol LINCS:LSM-3847 |
|
| definition |
A phenol resulting from the formal substitution of the hydrogen at the 2 position of 1,3-diisopropylbenzene by a hydroxy group. |
|
| formula |
C12H18O |
|
| has_alternative_id |
CHEBI:8495 CHEBI:44914 |
|
| has_exact_synonym |
2,6-bis(propan-2-yl)phenol Propofol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Disoprivan 2,6-bis(1-methylethyl)phenol 2,6-Diisopropylphenol propofol Disoprofol propofolum Diprivan 2,6-BIS(1-METHYLETHYL)PHENOL Rapinovet |
|
| has_role |
http://purl.obolibrary.org/obo/CHEBI_38877 http://purl.obolibrary.org/obo/CHEBI_50919 |
|
| id |
CHEBI:44915 |
|
| in_subset | ||
| inchi |
InChI=1S/C12H18O/c1-8(2)10-6-5-7-11(9(3)4)12(10)13/h5-9,13H,1-4H3 |
|
| inchikey |
OLBCVFGFOZPWHH-UHFFFAOYSA-N |
|
| label |
propofol |
|
| mass |
178.27072 |
|
| monoisotopicmass |
178.13577 |
|
| notation |
CHEBI:44915 |
|
| smiles |
CC(C)c1cccc(C(C)C)c1O |
|
| subClassOf |