Preferred Name |
|
|
Synonyms |
Nimesulide N-(4-nitro-2-phenoxyphenyl)methanesulfonamide 4'-nitro-2'-phenoxymethanesulfonanilide 4-NITRO-2-PHENOXYMETHANESULFONANILIDE |
|
Definitions |
An aromatic ether having phenyl and 2-methylsulfonamido-5-nitrophenyl as the two aryl groups. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_44445 |
|
charge |
0 |
|
database_cross_reference |
CAS:51803-78-2 Reaxys:2421175 PMID:18426087 PDBeChem:NIM Drug_Central:1935 LINCS:LSM-3718 VSDB:1893 KEGG:D01049 Wikipedia:Nimesulide DrugBank:DB04743 Beilstein:2421175 |
|
definition |
An aromatic ether having phenyl and 2-methylsulfonamido-5-nitrophenyl as the two aryl groups. |
|
formula |
C13H12N2O5S |
|
has_alternative_id |
CHEBI:44440 CHEBI:7574 |
|
has_exact_synonym |
Nimesulide N-(4-nitro-2-phenoxyphenyl)methanesulfonamide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
4'-nitro-2'-phenoxymethanesulfonanilide 4-NITRO-2-PHENOXYMETHANESULFONANILIDE |
|
id |
CHEBI:44445 |
|
in_subset | ||
inchi |
InChI=1S/C13H12N2O5S/c1-21(18,19)14-12-8-7-10(15(16)17)9-13(12)20-11-5-3-2-4-6-11/h2-9,14H,1H3 |
|
inchikey |
HYWYRSMBCFDLJT-UHFFFAOYSA-N |
|
label |
nimesulide |
|
mass |
308.31000 |
|
monoisotopicmass |
308.04669 |
|
notation |
CHEBI:44445 |
|
smiles |
CS(=O)(=O)Nc1ccc(cc1Oc1ccccc1)[N+]([O-])=O |
|
subClassOf |