loading...| Preferred Name |
|
|
| Synonyms |
Dantrolene 1-({[5-(4-nitrophenyl)furan-2-yl]methylidene}amino)imidazolidine-2,4-dione 1-((5-(p-nitrophenyl)furfurylidene)amino)hydantoin dantroleno dantrolenum dantrolene |
|
| Definitions |
The hydrazone resulting from the formal condensation of 5-(4-nitrophenyl)furfural with 1-aminohydantoin. A ryanodine receptor antagonist used for the relief of chronic severe spasticity and malignant hyperthermia. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4317 |
|
| charge |
0 |
|
| database_cross_reference |
Beilstein:705189 PMID:29921212 PMID:31901380 PMID:31478931 CAS:7261-97-4 PMID:31775359 PMID:30776519 DrugBank:DB01219 KEGG:C06939 Patent:US3415821 PMID:11934664 PMID:31337666 PMID:31906750 PMID:8797628 PMID:30948257 PMID:18696266 PMID:31918212 PMID:32060500 Patent:NL6612588 PMID:32016838 KEGG:D02347 LINCS:LSM-3823 PMID:31633504 PMID:31851793 |
|
| definition |
The hydrazone resulting from the formal condensation of 5-(4-nitrophenyl)furfural with 1-aminohydantoin. A ryanodine receptor antagonist used for the relief of chronic severe spasticity and malignant hyperthermia. |
|
| formula |
C14H10N4O5 |
|
| has_exact_synonym |
Dantrolene 1-({[5-(4-nitrophenyl)furan-2-yl]methylidene}amino)imidazolidine-2,4-dione |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
1-((5-(p-nitrophenyl)furfurylidene)amino)hydantoin dantroleno dantrolenum dantrolene |
|
| id |
CHEBI:4317 |
|
| in_subset | ||
| inchi |
InChI=1S/C14H10N4O5/c19-13-8-17(14(20)16-13)15-7-11-5-6-12(23-11)9-1-3-10(4-2-9)18(21)22/h1-7H,8H2,(H,16,19,20) |
|
| inchikey |
OZOMQRBLCMDCEG-UHFFFAOYSA-N |
|
| label |
dantrolene |
|
| mass |
314.257 |
|
| monoisotopicmass |
314.06512 |
|
| notation |
CHEBI:4317 |
|
| smiles |
C1(NC(=O)CN1N=C(C=2OC(C=3C=CC([N+]([O-])=O)=CC3)=CC2)[H])=O |
|
| subClassOf |