Preferred Name |
curcumin |
|
Synonyms |
curcumin Curcumin (1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione Turmeric yellow C.I. 75300 C.I. Natural Yellow 3 Diferuloylmethane Kacha haldi E 100 Natural yellow 3 |
|
Definitions |
A beta-diketone that is methane in which two of the hydrogens are substituted by feruloyl groups. A natural dyestuff found in the root of Curcuma longa. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3962 |
|
charge |
0 |
|
database_cross_reference |
PMID:14634121 PMID:19204190 PMID:34473340 PMID:21466422 PMID:14561543 PMID:20645870 PMID:15129424 Reaxys:2306965 PMID:17182546 PMID:12083767 PMID:34572491 Chemspider:839564 Wikipedia:Curcumin PMID:12450549 KNApSAcK:C00002731 PMID:15879598 PMID:22211691 MetaCyc:CPD-6602 PMID:22044005 LINCS:LSM-43083 PMID:19038979 DrugBank:DB11672 PMID:22122768 PMID:22753715 Patent:DE859145 PMID:22318308 PMID:15659840 PMID:15753945 PMID:23574161 PMID:21642934 PMID:23386263 PMID:16292655 PMID:22118895 HMDB:HMDB0002269 PMID:15842781 Patent:KR20130050834 PMID:34572272 PDBeChem:CC9 PMID:22051121 PMID:16972983 PMID:15809436 CAS:458-37-7 PMID:9698073 PMID:16712454 PMID:16276182 PMID:18815282 PMID:20057137 PMID:10923784 PMID:12826232 KEGG:C10443 PMID:16413584 PMID:19234767 PMID:34299604 |
|
definition |
A beta-diketone that is methane in which two of the hydrogens are substituted by feruloyl groups. A natural dyestuff found in the root of Curcuma longa. |
|
formula |
C21H20O6 |
|
has_exact_synonym |
curcumin Curcumin (1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Turmeric yellow C.I. 75300 C.I. Natural Yellow 3 Diferuloylmethane Kacha haldi E 100 Natural yellow 3 |
|
id |
CHEBI:3962 |
|
in_subset | ||
inchi |
InChI=1S/C21H20O6/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2/h3-12,24-25H,13H2,1-2H3/b7-3+,8-4+ |
|
inchikey |
VFLDPWHFBUODDF-FCXRPNKRSA-N |
|
label |
curcumin |
|
mass |
368.385 |
|
monoisotopicmass |
368.12599 |
|
notation |
CHEBI:3962 |
|
prefLabel |
curcumin |
|
smiles |
COC1=C(O)C=CC(\C=C\C(=O)CC(=O)\C=C\C2=CC(OC)=C(O)C=C2)=C1 |
|
subClassOf |