loading...| Preferred Name |
|
|
| Synonyms |
Clofibrate ethyl 2-(4-chlorophenoxy)-2-methylpropanoate 2-(p-Chlorophenoxy)-2-methylpropionic acid ethyl ester Ethyl 2-(p-chlorophenoxy)isobutyrate clofibrate Atromid-S clofibrato Lipofacton Ethyl chlorophenoxyisobutyrate 2-(4-Chlorophenoxy)-2-methylpropanoic acid ethyl ester ELPI alpha-(p-Chlorophenoxy)isobutyric acid, ethyl ester Ethyl clofibrate EPIB clofibratum alpha-p-Chlorophenoxyisobutyryl ethyl ester Liprin |
|
| Definitions |
The ethyl ester of clofibric acid. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3750 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG COMPOUND:637-07-0 SNOMEDCT:77035009 MeSH:D002994 Beilstein:1913459 SNOMEDCT:387439004 KEGG DRUG:D00279 KEGG COMPOUND:C06916 ChemIDplus:637-07-0 ChEMBL:116415 NCIt:C378 PMID:33893992 KEGG:C06916 LINCS:LSM-2996 PMID:28779283 Wikipedia:Clofibrate PMID:26949064 KEGG:D00279 PMID:23603800 PMID:28248971 PMID:30642049 HMDB:HMDB0014774 PMID:28512725 Drug_Central:694 PMID:28485676 PMCID:PMC7258001 Patent:US3262850 PMID:29059162 CAS:637-07-0 Patent:GB860303 PMCID:PMC8265473 PMID:27354598 DrugBank:DB00636 Chemspider:2694 PMID:33070841 |
|
| definition |
The ethyl ester of clofibric acid. |
|
| formula |
C12H15ClO3 |
|
| has_exact_synonym |
Clofibrate ethyl 2-(4-chlorophenoxy)-2-methylpropanoate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-(p-Chlorophenoxy)-2-methylpropionic acid ethyl ester Ethyl 2-(p-chlorophenoxy)isobutyrate clofibrate Atromid-S clofibrato Lipofacton Ethyl chlorophenoxyisobutyrate 2-(4-Chlorophenoxy)-2-methylpropanoic acid ethyl ester ELPI alpha-(p-Chlorophenoxy)isobutyric acid, ethyl ester Ethyl clofibrate EPIB clofibratum alpha-p-Chlorophenoxyisobutyryl ethyl ester Liprin |
|
| id |
CHEBI:3750 |
|
| in_subset | ||
| inchi |
InChI=1S/C12H15ClO3/c1-4-15-11(14)12(2,3)16-10-7-5-9(13)6-8-10/h5-8H,4H2,1-3H3 |
|
| inchikey |
KNHUKKLJHYUCFP-UHFFFAOYSA-N |
|
| label |
clofibrate |
|
| mass |
242.69900 |
|
| monoisotopicmass |
242.07097 |
|
| notation |
CHEBI:3750 |
|
| smiles |
CCOC(=O)C(C)(C)Oc1ccc(Cl)cc1 |
|
| subClassOf |