loading...| Preferred Name |
|
|
| Synonyms |
2-cyano-1-methyl-3-(2-{[(5-methyl-1H-imidazol-4-yl)methyl]sulfanyl}ethyl)guanidine Cimetag cimetidinum cimetidina N-cyano-N'-methyl-N''-(2-([(5-methyl-1H-imidazol-4-yl)methyl]sulfanyl)ethyl)guanidine N''-cyano-N-methyl-N'-(2-{[(5-methyl-1H-imidazol-4-yl)methyl]thio}ethyl)guanidine 2-cyano-1-methyl-3-(2-(((5-methylimidazol-4-yl)methyl)thio)ethyl)guanidine Tagamet HB 200 cimetidine Ulcerfen 1-Cyano-2-methyl-3-(2-(((5-methyl-4-imidazolyl)methyl)thio)ethyl)guanidine |
|
| Definitions |
A member of the class of guanidines that consists of guanidine carrying a methyl substituent at position 1, a cyano group at position 2 and a 2-{[(5-methyl-1H-imidazol-4-yl)methyl]sulfanyl}ethyl group at position 3. It is a H2-receptor antagonist that inhibits the production of acid in stomach. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3699 |
|
| charge |
0 |
|
| database_cross_reference |
HMDB:HMDB0014644 DrugBank:DB00501 PMID:11910267 PMID:15637527 CAS:51481-61-9 Reaxys:6516325 LINCS:LSM-2404 Drug_Central:645 Patent:BE804144 KEGG:D00295 Wikipedia:Cimetidine Patent:US3950333 VSDB:1892 PMID:7229121 |
|
| definition |
A member of the class of guanidines that consists of guanidine carrying a methyl substituent at position 1, a cyano group at position 2 and a 2-{[(5-methyl-1H-imidazol-4-yl)methyl]sulfanyl}ethyl group at position 3. It is a H2-receptor antagonist that inhibits the production of acid in stomach. |
|
| formula |
C10H16N6S |
|
| has_exact_synonym |
2-cyano-1-methyl-3-(2-{[(5-methyl-1H-imidazol-4-yl)methyl]sulfanyl}ethyl)guanidine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Cimetag cimetidinum cimetidina N-cyano-N'-methyl-N''-(2-([(5-methyl-1H-imidazol-4-yl)methyl]sulfanyl)ethyl)guanidine N''-cyano-N-methyl-N'-(2-{[(5-methyl-1H-imidazol-4-yl)methyl]thio}ethyl)guanidine 2-cyano-1-methyl-3-(2-(((5-methylimidazol-4-yl)methyl)thio)ethyl)guanidine Tagamet HB 200 cimetidine Ulcerfen 1-Cyano-2-methyl-3-(2-(((5-methyl-4-imidazolyl)methyl)thio)ethyl)guanidine |
|
| id |
CHEBI:3699 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H16N6S/c1-8-9(16-7-15-8)5-17-4-3-13-10(12-2)14-6-11/h7H,3-5H2,1-2H3,(H,15,16)(H2,12,13,14) |
|
| inchikey |
AQIXAKUUQRKLND-UHFFFAOYSA-N |
|
| label |
cimetidine |
|
| mass |
252.34048 |
|
| monoisotopicmass |
252.11572 |
|
| notation |
CHEBI:3699 |
|
| smiles |
CN\C(NCCSCc1nc[nH]c1C)=N\C#N |
|
| subClassOf |