Preferred Name |
|
|
Synonyms |
Chloroquine N(4)-(7-chloroquinolin-4-yl)-N(1),N(1)-diethylpentane-1,4-diamine Resoquine Bemaphate Capquin Nivaquine B Artrichin chloroquine chloroquinum Chlorochin N(4)-(7-chloro-4-quinolinyl)-N(1),N(1)-diethyl-1,4-pentanediamine Sanoquin cloroquina Aralen Reumachlor |
|
Definitions |
An aminoquinoline that is quinoline which is substituted at position 4 by a [5-(diethylamino)pentan-2-yl]amino group at at position 7 by chlorine. It is used for the treatment of malaria, hepatic amoebiasis, lupus erythematosus, light-sensitive skin eruptions, and rheumatoid arthritis. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3638 |
|
charge |
0 |
|
database_cross_reference |
SNOMEDCT:373468005 MeSH:D002738 NCIt:C61671 SNOMEDCT:14728000 Patent:DE683692 PMID:17594118 DrugBank:DB00608 Gmelin:781126 Wikipedia:Chloroquine PMID:25285162 PMID:19426658 Drug_Central:607 PDBeChem:CLQ PMID:23644906 PMID:18052874 PMID:23635029 PMID:23706562 PMID:23580861 LINCS:LSM-1901 PMID:11198399 Reaxys:482809 PMID:23852712 PMID:23891850 KEGG:C07625 CAS:54-05-7 Beilstein:482809 Patent:US2233970 PMID:23288916 KEGG:D02366 HMDB:HMDB0014746 |
|
definition |
An aminoquinoline that is quinoline which is substituted at position 4 by a [5-(diethylamino)pentan-2-yl]amino group at at position 7 by chlorine. It is used for the treatment of malaria, hepatic amoebiasis, lupus erythematosus, light-sensitive skin eruptions, and rheumatoid arthritis. |
|
formula |
C18H26ClN3 |
|
has_exact_synonym |
Chloroquine N(4)-(7-chloroquinolin-4-yl)-N(1),N(1)-diethylpentane-1,4-diamine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Resoquine Bemaphate Capquin Nivaquine B Artrichin chloroquine chloroquinum Chlorochin N(4)-(7-chloro-4-quinolinyl)-N(1),N(1)-diethyl-1,4-pentanediamine Sanoquin cloroquina Aralen Reumachlor |
|
has_role | ||
id |
CHEBI:3638 |
|
in_subset | ||
inchi |
InChI=1S/C18H26ClN3/c1-4-22(5-2)12-6-7-14(3)21-17-10-11-20-18-13-15(19)8-9-16(17)18/h8-11,13-14H,4-7,12H2,1-3H3,(H,20,21) |
|
inchikey |
WHTVZRBIWZFKQO-UHFFFAOYSA-N |
|
label |
chloroquine |
|
mass |
319.87200 |
|
monoisotopicmass |
319.18153 |
|
notation |
CHEBI:3638 |
|
smiles |
CCN(CC)CCCC(C)Nc1ccnc2cc(Cl)ccc12 |
|
subClassOf |