Preferred Name |
|
|
Synonyms |
SEROTONIN Serotonin 3-(2-aminoethyl)-1H-indol-5-ol serotonine thrombotonin Enteramine 3-(2-Aminoethyl)-1H-indol-5-ol thrombocytin 5-HT 5-Hydroxytryptamine |
|
Definitions |
A primary amino compound that is the 5-hydroxy derivative of tryptamine. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_28790 |
|
charge |
0 |
|
database_cross_reference |
ChemIDplus:50-67-9 MeSH:D012701 KEGG COMPOUND:50-67-9 Beilstein:143524 Gmelin:1861995 SNOMEDCT:33635003 KEGG COMPOUND:C00780 NCIt:C828 LINCS:LSM-6589 Reaxys:143524 PMID:22770225 Wikipedia:Serotonin HMDB:HMDB0000259 KEGG:C00780 PMID:18593914 PMID:24136337 PDBeChem:SRO KNApSAcK:C00001429 MetaCyc:SEROTONIN CAS:50-67-9 |
|
definition |
A primary amino compound that is the 5-hydroxy derivative of tryptamine. |
|
formula |
C10H12N2O |
|
has_alternative_id |
CHEBI:1420 CHEBI:26652 CHEBI:49894 |
|
has_exact_synonym |
SEROTONIN Serotonin 3-(2-aminoethyl)-1H-indol-5-ol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
serotonine thrombotonin Enteramine 3-(2-Aminoethyl)-1H-indol-5-ol thrombocytin 5-HT 5-Hydroxytryptamine |
|
id |
CHEBI:28790 |
|
in_subset | ||
inchi |
InChI=1S/C10H12N2O/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10/h1-2,5-6,12-13H,3-4,11H2 |
|
inchikey |
QZAYGJVTTNCVMB-UHFFFAOYSA-N |
|
label |
serotonin |
|
mass |
176.215 |
|
monoisotopicmass |
176.09496 |
|
notation |
CHEBI:28790 |
|
smiles |
C1=CC(=CC=2C(=CNC12)CCN)O |
|
subClassOf |