loading...| Preferred Name |
|
|
| Synonyms |
Acrylamide prop-2-enamide acrylamide 2-Propenamide ethylenecarboxamide Akrylamid |
|
| Definitions |
A member of the class of acrylamides that results from the formal condensation of acrylic acid with ammonia. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28619 |
|
| charge |
0 |
|
| database_cross_reference |
MeSH:D020106 NCIt:C44329 SNOMEDCT:6983000 CAS:79-06-1 PMID:12166997 UM-BBD_compID:c0149 PMID:15240786 PMID:19022940 Patent:US2535245 PMID:15901921 Reaxys:605349 PMID:18469268 PMID:19846048 PMID:10719038 PMID:17558658 Gmelin:81842 PMID:17484107 PMID:17720246 Beilstein:605349 PMID:22784192 PMID:7767980 KEGG:C01659 HMDB:HMDB0004296 PMID:22136129 PMID:17032038 Wikipedia:Acrylamide PMID:17234719 |
|
| definition |
A member of the class of acrylamides that results from the formal condensation of acrylic acid with ammonia. |
|
| formula |
C3H5NO |
|
| has_alternative_id |
CHEBI:22215 CHEBI:2441 |
|
| has_exact_synonym |
Acrylamide prop-2-enamide acrylamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-Propenamide ethylenecarboxamide Akrylamid |
|
| id |
CHEBI:28619 |
|
| in_subset | ||
| inchi |
InChI=1S/C3H5NO/c1-2-3(4)5/h2H,1H2,(H2,4,5) |
|
| inchikey |
HRPVXLWXLXDGHG-UHFFFAOYSA-N |
|
| label |
acrylamide |
|
| mass |
71.07794 |
|
| monoisotopicmass |
71.03711 |
|
| notation |
CHEBI:28619 |
|
| smiles |
NC(=O)C=C |
|
| subClassOf |