loading...| Preferred Name |
|
|
| Synonyms |
DIMETHYL SULFOXIDE dimethyl sulfoxide (methanesulfinyl)methane Dimethyl sulfoxide methylsulfinylmethane Dimethylsulfoxid dimethyl sulfur oxide S(O)Me2 dimethylsulfoxyde DMSO dimetil sulfoxido sulfinylbis(methane) dmso (CH3)2SO dimethyli sulfoxidum dimethyl sulphoxide |
|
| Definitions |
A 2-carbon sulfoxide in which the sulfur atom has two methyl substituents. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28262 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG DRUG:D01043 NIST Chemistry WebBook:67-68-5 CiteXplore:15588915 ChEMBL:110009 UM-BBD:c0236 Reaxys:506008 Beilstein:506008 Wikipedia:Dimethyl_Sulfoxide MeSH:D004121 CiteXplore:22030943 CiteXplore:21426213 KEGG COMPOUND:67-68-5 Gmelin:1556 KEGG COMPOUND:C11143 ChemIDplus:67-68-5 CiteXplore:11350866 NCIt:C437 PMID:20828537 UM-BBD_compID:c0236 PMID:19096138 KEGG:C11143 PMID:23313473 PMID:4963226 PMID:19443933 PMID:11350866 PMID:11474739 HMDB:HMDB0002151 PMID:22030943 PMID:6379027 FooDB:FDB000764 PMID:4223708 PMID:4556944 PMID:22814967 KNApSAcK:C00053120 PMID:29938311 PMID:23050031 KEGG:D01043 CAS:67-68-5 PMID:16434015 PMID:15588915 PMID:15237653 PMID:21426213 PMID:16522014 PMID:3916302 Drug_Central:906 PMID:10298633 PMID:15868171 PMID:6309056 DrugBank:DB01093 LINCS:LSM-36361 PMID:19382398 PMID:3510103 Chemspider:659 PMID:11162043 PMID:3898376 Wikipedia:Dimethyl_sulfoxide PDBeChem:DMS PMID:22722716 MetaCyc:DMSO PMID:31489176 PMID:28220525 PMID:12663039 PMID:22768202 |
|
| definition |
A 2-carbon sulfoxide in which the sulfur atom has two methyl substituents. |
|
| formula |
C2H6OS |
|
| has_alternative_id |
CHEBI:23801 CHEBI:4612 CHEBI:42138 |
|
| has_exact_synonym |
DIMETHYL SULFOXIDE dimethyl sulfoxide (methanesulfinyl)methane Dimethyl sulfoxide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
methylsulfinylmethane dimethyl sulfoxide Dimethylsulfoxid dimethyl sulfur oxide S(O)Me2 dimethylsulfoxyde DMSO dimetil sulfoxido sulfinylbis(methane) dmso (CH3)2SO dimethyli sulfoxidum dimethyl sulphoxide |
|
| id |
CHEBI:28262 |
|
| in_subset | ||
| inchi |
InChI=1S/C2H6OS/c1-4(2)3/h1-2H3 |
|
| inchikey |
IAZDPXIOMUYVGZ-UHFFFAOYSA-N |
|
| label |
dimethyl sulfoxide |
|
| mass |
78.13444 |
|
| monoisotopicmass |
78.01394 |
|
| notation |
CHEBI:28262 |
|
| smiles |
CS(C)=O |
|
| subClassOf |