Preferred Name |
|
|
Synonyms |
Phenylalanine 2-amino-3-phenylpropanoic acid phenylalanine PHE Phenylalanin DL-Phenylalanine alpha-Amino-beta-phenylpropionic acid F fenilalanina |
|
Definitions |
An aromatic amino acid that is alanine in which one of the methyl hydrogens is substituted by a phenyl group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_28044 |
|
charge |
0 |
|
database_cross_reference |
SNOMEDCT:63004003 KEGG COMPOUND:C02057 ChemIDplus:150-30-1 MeSH:D010649 Gmelin:50836 NIST Chemistry WebBook:150-30-1 NCIt:C29601 SNOMEDCT:421626005 Beilstein:1910407 Wikipedia:Phenylalanine PMID:22264337 PMID:17439666 Reaxys:1910407 KEGG:C02057 CAS:150-30-1 |
|
definition |
An aromatic amino acid that is alanine in which one of the methyl hydrogens is substituted by a phenyl group. |
|
formula |
C9H11NO2 |
|
has_alternative_id |
CHEBI:8089 CHEBI:25984 |
|
has_exact_synonym |
Phenylalanine 2-amino-3-phenylpropanoic acid phenylalanine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
PHE Phenylalanin DL-Phenylalanine alpha-Amino-beta-phenylpropionic acid F fenilalanina |
|
id |
CHEBI:28044 |
|
in_subset | ||
inchi |
InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12) |
|
inchikey |
COLNVLDHVKWLRT-UHFFFAOYSA-N |
|
label |
phenylalanine |
|
mass |
165.18918 |
|
monoisotopicmass |
165.07898 |
|
notation |
CHEBI:28044 |
|
OBI_0000316 |
http://livercancer.imbi.uni-heidelberg.de/ccont#CCONT_0000002 |
|
prefixIRI |
CHEBI:28044 |
|
smiles |
NC(Cc1ccccc1)C(O)=O |
|
subClassOf |