Preferred Name |
|
|
Synonyms |
ALDOSTERONE Aldosterone aldosterone 11beta,21-dihydroxy-3,20-dioxopregn-4-en-18-al (11beta)-11,21-dihydroxy-3,20-dioxopregn-4-en-18-al 11beta,21-Dihydroxy-3,20-dioxo-4-pregnen-18-al (+)-aldosterone |
|
Definitions |
A pregnane-based steroidal hormone produced by the outer-section (zona glomerulosa) of the adrenal cortex in the adrenal gland, and acts on the distal tubules and collecting ducts of the kidney to cause the conservation of sodium, secretion of potassium, increased water retention, and increased blood pressure. The overall effect of aldosterone is to increase reabsorption of ions and water in the kidney. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_27584 |
|
charge |
0 |
|
database_cross_reference |
MeSH:D000450 SNOMEDCT:42605004 NCIt:C219 DrugBank:DB04630 LIPID_MAPS_instance:LMST02030026 LINCS:LSM-42770 PMID:10438974 Wikipedia:Aldosterone Drug_Central:111 CAS:52-39-1 PDBeChem:AS4 Beilstein:3224996 KEGG:C01780 Reaxys:3224996 HMDB:HMDB0000037 |
|
definition |
A pregnane-based steroidal hormone produced by the outer-section (zona glomerulosa) of the adrenal cortex in the adrenal gland, and acts on the distal tubules and collecting ducts of the kidney to cause the conservation of sodium, secretion of potassium, increased water retention, and increased blood pressure. The overall effect of aldosterone is to increase reabsorption of ions and water in the kidney. |
|
formula |
C21H28O5 |
|
has_alternative_id |
CHEBI:40919 CHEBI:2563 CHEBI:22306 |
|
has_exact_synonym |
ALDOSTERONE Aldosterone aldosterone 11beta,21-dihydroxy-3,20-dioxopregn-4-en-18-al |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(11beta)-11,21-dihydroxy-3,20-dioxopregn-4-en-18-al 11beta,21-Dihydroxy-3,20-dioxo-4-pregnen-18-al (+)-aldosterone |
|
has_role | ||
id |
CHEBI:27584 |
|
in_subset | ||
inchi |
InChI=1S/C21H28O5/c1-20-7-6-13(24)8-12(20)2-3-14-15-4-5-16(18(26)10-22)21(15,11-23)9-17(25)19(14)20/h8,11,14-17,19,22,25H,2-7,9-10H2,1H3/t14-,15-,16+,17-,19+,20-,21+/m0/s1 |
|
inchikey |
PQSUYGKTWSAVDQ-ZVIOFETBSA-N |
|
label |
aldosterone |
|
mass |
360.44400 |
|
monoisotopicmass |
360.19367 |
|
notation |
CHEBI:27584 |
|
smiles |
[H][C@@]1(CC[C@@]2([H])[C@]3([H])CCC4=CC(=O)CC[C@]4(C)[C@@]3([H])[C@@H](O)C[C@]12C=O)C(=O)CO |
|
subClassOf |