Preferred Name |
|
|
Synonyms |
2,6-diaminohexanoic acid lysine alpha,epsilon-diaminocaproic acid Lysin K LYS |
|
Definitions |
A diamino acid that is caproic (hexanoic) acid bearing two amino substituents at positions 2 and 6. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_25094 |
|
charge |
0 |
|
database_cross_reference |
ChemIDplus:70-54-2 MeSH:D008239 SNOMEDCT:75799006 Gmelin:279284 NIST Chemistry WebBook:70-54-2 Beilstein:1616991 NCIt:C29171 SNOMEDCT:418834008 Reaxys:1616991 PMID:22264337 PMID:17439666 Wikipedia:Lysine KEGG:C16440 CAS:70-54-2 |
|
definition |
A diamino acid that is caproic (hexanoic) acid bearing two amino substituents at positions 2 and 6. |
|
formula |
C6H14N2O2 |
|
has_exact_synonym |
2,6-diaminohexanoic acid lysine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
alpha,epsilon-diaminocaproic acid Lysin K LYS |
|
id |
CHEBI:25094 |
|
in_subset | ||
inchi |
InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10) |
|
inchikey |
KDXKERNSBIXSRK-UHFFFAOYSA-N |
|
label |
lysine |
|
mass |
146.18764 |
|
monoisotopicmass |
146.10553 |
|
notation |
CHEBI:25094 |
|
OBI_0000316 |
http://livercancer.imbi.uni-heidelberg.de/ccont#CCONT_0000002 |
|
prefixIRI |
CHEBI:25094 |
|
smiles |
NCCCCC(N)C(O)=O |
|
subClassOf |