Preferred Name |
|
|
Synonyms |
adenine 9H-purin-6-amine Adenine ADENINE Ade A 6-Aminopurine Adenin |
|
Definitions |
The parent compound of the 6-aminopurines, composed of a purine having an amino group at C-6. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16708 |
|
charge |
0 |
|
database_cross_reference |
PMID:11985597 HMDB:HMDB0000034 KEGG:C00147 PDBeChem:ADE Beilstein:608603 PMID:12829005 PMID:17439666 PMID:15063338 PMID:15715490 Drug_Central:89 Gmelin:3903 MetaCyc:ADENINE Wikipedia:Adenine DrugBank:DB00173 KEGG:D00034 KNApSAcK:C00001490 CAS:73-24-5 Reaxys:608603 PMID:12951489 PMID:8070089 |
|
definition |
The parent compound of the 6-aminopurines, composed of a purine having an amino group at C-6. |
|
formula |
C5H5N5 |
|
has_alternative_id |
CHEBI:2470 CHEBI:40579 CHEBI:22236 CHEBI:13733 |
|
has_exact_synonym |
adenine 9H-purin-6-amine Adenine ADENINE |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Ade A 6-Aminopurine Adenin |
|
id |
CHEBI:16708 |
|
in_subset | ||
inchi |
InChI=1S/C5H5N5/c6-4-3-5(9-1-7-3)10-2-8-4/h1-2H,(H3,6,7,8,9,10) |
|
inchikey |
GFFGJBXGBJISGV-UHFFFAOYSA-N |
|
label |
adenine |
|
mass |
135.12690 |
|
monoisotopicmass |
135.05450 |
|
notation |
CHEBI:16708 |
|
smiles |
Nc1ncnc2[nH]cnc12 |
|
subClassOf |