loading...| Preferred Name |
|
|
| Synonyms |
SARCOSINE Sarcosine sarcosine N-methylaminoacetic acid (methylamino)acetic acid Sar N-Methylglycine MeGly (methylamino)ethanoic acid L-sarcosine methylaminoacetic acid sarcosinic acid |
|
| Definitions |
A N-alkylglycine that is the N-methyl derivative of glycine. It is an intermediate in the metabolic pathway of glycine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_15611 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:11272730 HMDB:HMDB0000271 PMID:17095900 Wikipedia:Sarcosine PMID:19433577 KEGG:C00213 PMID:19944746 CAS:107-97-1 UM-BBD_compID:c0135 PMID:16154544 Gmelin:2018 Beilstein:1699442 PMID:11850512 MetaCyc:SARCOSINE PMID:15331688 PMID:15023571 PMID:19577367 PMID:19619564 PMID:17901997 PDBeChem:SAR PMID:17190852 Reaxys:1699442 |
|
| definition |
A N-alkylglycine that is the N-methyl derivative of glycine. It is an intermediate in the metabolic pathway of glycine. |
|
| formula |
C3H7NO2 |
|
| has_alternative_id |
CHEBI:10876 CHEBI:45381 CHEBI:9029 CHEBI:15065 CHEBI:45614 CHEBI:21765 CHEBI:45531 CHEBI:12609 CHEBI:45442 |
|
| has_exact_synonym |
SARCOSINE Sarcosine sarcosine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
N-methylaminoacetic acid (methylamino)acetic acid Sar N-Methylglycine MeGly (methylamino)ethanoic acid L-sarcosine methylaminoacetic acid sarcosinic acid |
|
| id |
CHEBI:15611 |
|
| in_subset | ||
| inchi |
InChI=1S/C3H7NO2/c1-4-2-3(5)6/h4H,2H2,1H3,(H,5,6) |
|
| inchikey |
FSYKKLYZXJSNPZ-UHFFFAOYSA-N |
|
| label |
sarcosine |
|
| mass |
89.09322 |
|
| monoisotopicmass |
89.04768 |
|
| notation |
CHEBI:15611 |
|
| smiles |
CNCC(O)=O |
|
| subClassOf |