loading...| Preferred Name |
|
|
| Synonyms |
pyruvate 2-oxopropanoate 2-oxopropanoic acid, ion(1-) |
|
| Definitions |
A 2-oxo monocarboxylic acid anion that is the conjugate base of pyruvic acid, arising from deprotonation of the carboxy group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_15361 |
|
| charge |
-1 |
|
| database_cross_reference |
PMID:22006570 PMID:21823181 PMID:21854850 KEGG:C00022 Gmelin:2502 PMID:22451307 UM-BBD_compID:c0159 PMID:22458763 Beilstein:3587721 CAS:57-60-3 PMID:22016370 PMID:22215378 Reaxys:3587721 PMID:17190852 PMID:22311625 PMID:21603897 |
|
| definition |
A 2-oxo monocarboxylic acid anion that is the conjugate base of pyruvic acid, arising from deprotonation of the carboxy group. |
|
| formula |
C3H3O3 |
|
| has_alternative_id |
CHEBI:26462 CHEBI:14987 |
|
| has_exact_synonym |
pyruvate 2-oxopropanoate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-oxopropanoate 2-oxopropanoic acid, ion(1-) |
|
| id |
CHEBI:15361 |
|
| in_subset | ||
| inchi |
InChI=1S/C3H4O3/c1-2(4)3(5)6/h1H3,(H,5,6)/p-1 |
|
| inchikey |
LCTONWCANYUPML-UHFFFAOYSA-M |
|
| label |
pyruvate |
|
| mass |
87.05412 |
|
| monoisotopicmass |
87.00877 |
|
| notation |
CHEBI:15361 |
|
| smiles |
CC(=O)C([O-])=O |
|
| subClassOf |