Preferred Name |
|
|
Synonyms |
Acetone acetone propan-2-one ACETONE Dimethyl ketone Propanon 2-Propanone Azeton Dimethylketon propanone Aceton Pyroacetic ether methyl ketone beta-Ketopropane dimethylcetone dimethylketone |
|
Definitions |
A methyl ketone that consists of propane bearing an oxo group at C2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_15347 |
|
charge |
0 |
|
database_cross_reference |
KEGG:C00207 Beilstein:635680 LIPID_MAPS_instance:LMFA12000057 PDBeChem:ACN CAS:67-64-1 KEGG:D02311 MetaCyc:ACETONE Gmelin:1466 Wikipedia:Acetone Reaxys:635680 PMID:17347819 PMID:17190852 HMDB:HMDB0001659 UM-BBD_compID:c0556 |
|
definition |
A methyl ketone that consists of propane bearing an oxo group at C2. |
|
formula |
C3H6O |
|
has_alternative_id |
CHEBI:40571 CHEBI:13708 CHEBI:22182 CHEBI:2398 |
|
has_exact_synonym |
Acetone acetone propan-2-one ACETONE |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Dimethyl ketone Propanon 2-Propanone Azeton Dimethylketon propanone Aceton Pyroacetic ether methyl ketone beta-Ketopropane dimethylcetone dimethylketone |
|
id |
CHEBI:15347 |
|
in_subset | ||
inchi |
InChI=1S/C3H6O/c1-3(2)4/h1-2H3 |
|
inchikey |
CSCPPACGZOOCGX-UHFFFAOYSA-N |
|
label |
acetone |
|
mass |
58.07914 |
|
monoisotopicmass |
58.04186 |
|
notation |
CHEBI:15347 |
|
smiles |
CC(C)=O |
|
subClassOf |