loading...| Preferred Name |
|
|
| Synonyms |
1-ethyl-6-fluoro-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid NFLX norfloxacine 1-Ethyl-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylic acid norfloxacino 1-Ethyl-6-fluor-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-chinolincarbonsaeure 1,4-Dihydro-1-ethyl-6-fluoro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylic acid norfloxacinum norfloxacin |
|
| Definitions |
A quinolinemonocarboxylic acid with broad-spectrum antibacterial activity against most gram-negative and gram-positive bacteria. Norfloxacin is bactericidal and its mode of action depends on blocking of bacterial DNA replication by binding itself to an enzyme called DNA gyrase. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_100246 |
|
| charge |
0 |
|
| database_cross_reference |
Patent:DE2840910 "Patent" CiteXplore:6461606 "PubMed citation" Patent:BE863429 "Patent" CiteXplore:3317294 "PubMed citation" Wikipedia:Norfloxacin "Wikipedia" SNOMEDCT:387271008 CiteXplore:3908074 "PubMed citation" MeSH:D009643 CiteXplore:6224685 "PubMed citation" KEGG COMPOUND:C06687 "KEGG COMPOUND" Beilstein:567897 "Beilstein Registry Number" ChemIDplus:70458-96-7 "CAS Registry Number" CiteXplore:6234465 "PubMed citation" ChEMBL:100246 "ChEMBL COMPOUND" CiteXplore:6454381 "PubMed citation" Gmelin:1576626 "Gmelin Registry Number" KEGG COMPOUND:70458-96-7 "CAS Registry Number" KEGG DRUG:D00210 "KEGG DRUG" CiteXplore:6211142 "PubMed citation" NCIt:C47638 Patent:US4146719 "Patent" Patent:US4292317 "Patent" DrugBank:DB01059 "DrugBank" SNOMEDCT:49485009 PMID:6454381 PMID:6234465 Gmelin:1576626 Patent:DE2840910 Patent:US4146719 PMID:6461606 Drug_Central:1967 Patent:BE863429 Reaxys:567897 Patent:US4292317 PMID:6211142 KEGG:D00210 PMID:3908074 HMDB:HMDB0015192 LINCS:LSM-5286 VSDB:1831 Beilstein:567897 PMID:3317294 DrugBank:DB01059 Wikipedia:Norfloxacin PMID:6224685 CAS:70458-96-7 KEGG:C06687 |
|
| definition |
A quinolinemonocarboxylic acid with broad-spectrum antibacterial activity against most gram-negative and gram-positive bacteria. Norfloxacin is bactericidal and its mode of action depends on blocking of bacterial DNA replication by binding itself to an enzyme called DNA gyrase. |
|
| formula |
C16H18FN3O3 |
|
| has_alternative_id |
CHEBI:7629 |
|
| has_exact_synonym |
1-ethyl-6-fluoro-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
NFLX norfloxacine 1-Ethyl-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylic acid norfloxacino 1-Ethyl-6-fluor-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-chinolincarbonsaeure 1,4-Dihydro-1-ethyl-6-fluoro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylic acid norfloxacinum norfloxacin |
|
| has_role | ||
| id |
CHEBI:100246 |
|
| in_subset | ||
| inchi |
InChI=1S/C16H18FN3O3/c1-2-19-9-11(16(22)23)15(21)10-7-12(17)14(8-13(10)19)20-5-3-18-4-6-20/h7-9,18H,2-6H2,1H3,(H,22,23) |
|
| inchikey |
OGJPXUAPXNRGGI-UHFFFAOYSA-N |
|
| label |
norfloxacin |
|
| mass |
319.33080 |
|
| monoisotopicmass |
319.13322 |
|
| notation |
CHEBI:100246 |
|
| smiles |
CCn1cc(C(O)=O)c(=O)c2cc(F)c(cc12)N1CCNCC1 |
|
| subClassOf |