Preferred Name |
alanine |
|
Synonyms |
|
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16449 |
|
altId |
CHEBI:22277 CHEBI:13748 CHEBI:2539 |
|
Definition |
An alpha-amino acid that consists of propionic acid bearing an amino substituent at position 2. |
|
InChI |
InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6) |
|
InChIKey |
InChIKey=QNAYBMKLOCPYGJ-UHFFFAOYSA-N |
|
label |
alanine |
|
prefixIRI |
obo2:CHEBI_16449 |
|
prefLabel |
alanine |
|
SMILES |
CC(N)C(O)=O |
|
Synonym |
2-Aminopropionic acid 2-Aminopropanoic acid ALA Alanine Alanin C3H7NO2 alanina A alanine 2-aminopropanoic acid |
|
xref |
Beilstein:635807 Wikipedia:Alanine KEGG COMPOUND:302-72-7 ChemIDplus:302-72-7 Gmelin:2449 CiteXplore:17439666 Reaxys:635807 CiteXplore:22264337 KEGG COMPOUND:C01401 NIST Chemistry WebBook:302-72-7 |
|
subClassOf |
Create mapping