Preferred Name |
cysteine |
|
Synonyms |
|
|
ID |
http://purl.obolibrary.org/obo/CHEBI_15356 |
|
altId |
CHEBI:23508 CHEBI:4050 CHEBI:14061 |
|
Definition |
A sulfur-containing amino acid that is propanoic acid with an amino group at position 2 and a sulfanyl group at position 3. |
|
InChI |
InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6) |
|
InChIKey |
InChIKey=XUJNEKJLAYXESH-UHFFFAOYSA-N |
|
label |
cysteine |
|
prefixIRI |
obo2:CHEBI_15356 |
|
prefLabel |
cysteine |
|
SMILES |
NC(CS)C(O)=O |
|
Synonym |
C cisteina 2-amino-3-sulfanylpropanoic acid cysteine C3H7NO2S 2-Amino-3-mercaptopropionic acid Cys Zystein 2-amino-3-mercaptopropanoic acid Hcys Cysteine Cystein |
|
xref |
Wikipedia:Cysteine KEGG COMPOUND:3374-22-9 KNApSAcK:C00001351 Gmelin:2933 KNApSAcK:C00007323 ChemIDplus:3374-22-9 Reaxys:1721406 CiteXplore:17439666 NIST Chemistry WebBook:3374-22-9 Beilstein:1721406 CiteXplore:25181601 KEGG COMPOUND:C00736 |
|
subClassOf |
Create mapping