loading...| Preferred Name |
tetracaine |
|
| Synonyms |
|
|
| Definitions |
A local ester anaesthetic (ester caine) in which 4-N-butylbenzoic acid and 2-(dimethylamino)ethanol have combined to form the ester bond; used for surface and spinal anesthesia. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_9468 |
|
| alternative term |
tetracaine C15H24N2O2 tetracainum InChIKey=GKCBAIGFKIBETG-UHFFFAOYSA-N CCCCNc1ccc(cc1)C(=O)OCCN(C)C 2-(Dimethylamino)ethyl p-(butylamino)benzoate 2-(dimethylamino)ethyl 4-(butylamino)benzoate Diaethylaminoaethanol ester der p-butylaminobenzoesaeure tetracaina InChI=1S/C15H24N2O2/c1-4-5-10-16-14-8-6-13(7-9-14)15(18)19-12-11-17(2)3/h6-9,16H,4-5,10-12H2,1-3H3 p-Butylaminobenzoyl-2-dimethylaminoethanol |
|
| definition |
A local ester anaesthetic (ester caine) in which 4-N-butylbenzoic acid and 2-(dimethylamino)ethanol have combined to form the ester bond; used for surface and spinal anesthesia. |
|
| has role | ||
| label |
tetracaine |
|
| prefixIRI |
CHEBI:9468 |
|
| prefLabel |
tetracaine |
|
| subClassOf |