Preferred Name |
sulfamethizole |
|
Synonyms |
|
|
Definitions |
A 1,3,4-thiadiazole compound having a methyl substituent at the 5-position and a 4-aminobenzenesulfonamido group at the 2-position. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_9331 |
|
alternative term |
4-amino-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide InChIKey=VACCAVUAMIDAGB-UHFFFAOYSA-N C9H10N4O2S2 InChI=1S/C9H10N4O2S2/c1-6-11-12-9(16-6)13-17(14,15)8-4-2-7(10)3-5-8/h2-5H,10H2,1H3,(H,12,13) sulfametizol Sulfamethizole sulfamethizol Rufol Cc1nnc(NS(=O)(=O)c2ccc(N)cc2)s1 sulfamethizolum sulfamethizole |
|
definition |
A 1,3,4-thiadiazole compound having a methyl substituent at the 5-position and a 4-aminobenzenesulfonamido group at the 2-position. |
|
has role | ||
label |
sulfamethizole |
|
prefixIRI |
CHEBI:9331 |
|
prefLabel |
sulfamethizole |
|
subClassOf |
Create mapping