Preferred Name |
selenocysteine |
|
Synonyms |
|
|
Definitions |
A member of the selenocysteines that has formula C3H7NO2Se. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_9093 |
|
alternative term |
2-amino-3-selanylpropanoic acid C3H7NO2Se Selenozystein InChI=1S/C3H7NO2Se/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6) 3-selenoalanine NC(C[SeH])C(O)=O Selenocysteine InChIKey=ZKZBPNGNEQAJSX-UHFFFAOYSA-N Selenocystein |
|
definition |
A member of the selenocysteines that has formula C3H7NO2Se. |
|
has part | ||
is conjugate acid of | ||
is conjugate base of | ||
label |
selenocysteine |
|
prefixIRI |
CHEBI:9093 |
|
prefLabel |
selenocysteine |
|
subClassOf |
Create mapping