Jump to:
loading...| Preferred Name |
proguanil |
|
| Synonyms |
|
|
| Definitions |
A biguanide compound which has isopropyl and p-chlorophenyl substituents on the terminal N atoms. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8455 |
|
| alternative term |
Chlorguanide InChIKey=SSOLNOMRVKKSON-UHFFFAOYSA-N Chloroguanide CC(C)NC(=N)NC(=N)Nc1ccc(Cl)cc1 InChI=1S/C11H16ClN5/c1-7(2)15-10(13)17-11(14)16-9-5-3-8(12)4-6-9/h3-7H,1-2H3,(H5,13,14,15,16,17) proguanilum N-(4-Chlorophenyl)-N'-(isopropyl)-imidodicarbonimidic diamide C11H16ClN5 N-(4-chlorophenyl)-N'-(propan-2-yl)imidodicarbonimidic diamide proguanil 1-(p-chlorophenyl)-5-isopropylbiguanide |
|
| definition |
A biguanide compound which has isopropyl and p-chlorophenyl substituents on the terminal N atoms. |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_35820 |
|
| label |
proguanil |
|
| prefixIRI |
CHEBI:8455 |
|
| prefLabel |
proguanil |
|
| subClassOf |
Create mapping