Preferred Name |
procaine |
|
Synonyms |
|
|
Definitions |
A benzoate ester that has formula C13H20N2O2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_8430 |
|
alternative term |
CCN(CC)CCOC(=O)c1ccc(N)cc1 p-Aminobenzoic acid 2-diethylaminoethyl ester InChIKey=MFDFERRIHVXMIY-UHFFFAOYSA-N procaine procainum InChI=1S/C13H20N2O2/c1-3-15(4-2)9-10-17-13(16)11-5-7-12(14)8-6-11/h5-8H,3-4,9-10,14H2,1-2H3 Vitamin H3 C13H20N2O2 procaina beta-(diethylamino)ethyl 4-aminobenzoate beta-(diethylamino)ethyl p-aminobenzoate 2-Diethylaminoethyl p-aminobenzoate Procaine 2-(diethylamino)ethyl 4-aminobenzoate |
|
definition |
A benzoate ester that has formula C13H20N2O2. |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_49110 |
|
is conjugate base of | ||
label |
procaine |
|
prefixIRI |
CHEBI:8430 |
|
prefLabel |
procaine |
|
subClassOf |
Create mapping