Preferred Name |
neostigmine |
|
Synonyms |
|
|
Definitions |
A compound comprising an anilinium ion core having three methyl substituents on the aniline nitrogen, and a 3-[(dimethylcarbamoyl)oxy] substituent at position 3. It is a parasympathomimetic which acts as a reversible acetylcholinesterase inhibitor. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_7514 |
|
alternative term |
3-[(dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium Eustigmin Vagostigmine m-Trimethylammoniumphenyldimethylcarbamate CN(C)C(=O)Oc1cccc(c1)[N+](C)(C)C C12H19N2O2 (m-Hydroxyphenyl)trimethylammonium dimethylcarbamate 3-Trimethylammoniumphenyl N,N-dimethylcarbamate Prostigmine InChI=1S/C12H19N2O2/c1-13(2)12(15)16-11-8-6-7-10(9-11)14(3,4)5/h6-9H,1-5H3/q+1 Eustigmine InChIKey=ALWKGYPQUAPLQC-UHFFFAOYSA-N |
|
definition |
A compound comprising an anilinium ion core having three methyl substituents on the aniline nitrogen, and a 3-[(dimethylcarbamoyl)oxy] substituent at position 3. It is a parasympathomimetic which acts as a reversible acetylcholinesterase inhibitor. |
|
has role | ||
label |
neostigmine |
|
prefixIRI |
CHEBI:7514 |
|
prefLabel |
neostigmine |
|
subClassOf |