Preferred Name |
naproxen |
|
Synonyms |
|
|
Definitions |
A non-steroidal anti-inflammatory drug commonly used for the reduction of pain, fever, inflammation and stiffness caused by conditions such as osteoarthritis, kidney stones, rheumatoid arthritis, psoriatic arthritis, gout, ankylosing spondylitis, menstrual cramps, tendinitis, bursitis, and for the treatment of primary dysmenorrhea. It works by inhibiting both the COX-1 and COX-2 enzymes. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_7476 |
|
alternative term |
(+)-(S)-Naproxen (S)-(+)-2-(6-Methoxy-2-naphthyl)propionic acid (+)-2-(Methoxy-2-naphthyl)-propionsaeure naproxen InChIKey=CMWTZPSULFXXJA-VIFPVBQESA-N naproxeno Naproxen naproxenum (S)-2-(6-Methoxy-2-naphthyl)propanoic acid (2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid (+)-Naproxen (+)-2-(Methoxy-2-naphthyl)-propionic acid naproxene (+)-2-(6-Methoxy-2-naphthyl)propionic acid (S)-(+)-Naproxen COc1ccc2cc(ccc2c1)[C@H](C)C(O)=O (S)-2-(6-Methoxy-2-naphthyl)propionic acid (S)-6-Methoxy-alpha-methyl-2-naphthaleneacetic acid InChI=1S/C14H14O3/c1-9(14(15)16)10-3-4-12-8-13(17-2)6-5-11(12)7-10/h3-9H,1-2H3,(H,15,16)/t9-/m0/s1 (S)-Naproxen (+)-(S)-6-Methoxy-alpha-methyl-2-naphthaleneacetic acid |
|
definition |
A non-steroidal anti-inflammatory drug commonly used for the reduction of pain, fever, inflammation and stiffness caused by conditions such as osteoarthritis, kidney stones, rheumatoid arthritis, psoriatic arthritis, gout, ankylosing spondylitis, menstrual cramps, tendinitis, bursitis, and for the treatment of primary dysmenorrhea. It works by inhibiting both the COX-1 and COX-2 enzymes. |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_35493 http://purl.obolibrary.org/obo/CHEBI_50629 http://purl.obolibrary.org/obo/CHEBI_35475 |
|
is conjugate acid of | ||
label |
naproxen |
|
prefixIRI |
CHEBI:7476 |
|
prefLabel |
naproxen |
|
subClassOf |