Preferred Name |
methylphenidate |
|
Synonyms |
|
|
Definitions |
A carboxylic ester that has formula C14H19NO2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_6887 |
|
alternative term |
methyl alpha-phenyl-alpha-2-piperidinylacetate methyl alpha-phenyl-alpha-(2-piperidyl)acetate InChI=1S/C14H19NO2/c1-17-14(16)13(11-7-3-2-4-8-11)12-9-5-6-10-15-12/h2-4,7-8,12-13,15H,5-6,9-10H2,1H3 C14H19NO2 InChIKey=DUGOZIWVEXMGBE-UHFFFAOYSA-N Methylphenidate methyl phenyl(piperidin-2-yl)acetate methylphenidatum methylphenidate metilfenidato alpha-phenyl-2-piperidineacetic acid methyl ester COC(=O)C(C1CCCCN1)c1ccccc1 methyl phenidylacetate methylphenidan Daytrana |
|
definition |
A carboxylic ester that has formula C14H19NO2. |
|
is conjugate base of | ||
label |
methylphenidate |
|
prefixIRI |
CHEBI:6887 |
|
prefLabel |
methylphenidate |
|
subClassOf |
Create mapping