loading...| Preferred Name |
mesoridazine |
|
| Synonyms |
|
|
| Definitions |
A phenothiazine substituted at position 2 (para to the S atom) by a methylsulfinyl group, and on the nitrogen by a 2-(1-methylpiperidin-2-yl)ethyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6780 |
|
| alternative term |
TPS-23 2-Methanesulfinyl-10-[2-(1-methyl-piperidin-2-yl)-ethyl]-10H-phenothiazine thioridazine thiomethyl sulfoxide mesoridazina mesoridazinum C21H26N2OS2 InChIKey=SLVMESMUVMCQIY-UHFFFAOYSA-N 10-(2(1-Methyl-2-piperidyl)ethyl)-2-(methylsulfinyl)phenothiazine 10-[2-(1-methylpiperidin-2-yl)ethyl]-2-(methylsulfinyl)-10H-phenothiazine Mesoridazine mesoridazine CN1CCCCC1CCN1c2ccccc2Sc2ccc(cc12)S(C)=O thioridazine-2-sulfoxide InChI=1S/C21H26N2OS2/c1-22-13-6-5-7-16(22)12-14-23-18-8-3-4-9-20(18)25-21-11-10-17(26(2)24)15-19(21)23/h3-4,8-11,15-16H,5-7,12-14H2,1-2H3 10-(2-(1-Methyl-2-piperidyl)ethyl)-2-methylsulfinyl phenothiazine |
|
| definition |
A phenothiazine substituted at position 2 (para to the S atom) by a methylsulfinyl group, and on the nitrogen by a 2-(1-methylpiperidin-2-yl)ethyl group. |
|
| has role | ||
| label |
mesoridazine |
|
| prefixIRI |
CHEBI:6780 |
|
| prefLabel |
mesoridazine |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_32876 |