Preferred Name |
lithium carbonate |
|
Synonyms |
|
|
Definitions |
A carbonate salt that has formula CO3.2Li. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_6504 |
|
alternative term |
InChI=1S/CH2O3.2Li/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2 CLi2O3 InChIKey=XGZVUEUWXADBQD-UHFFFAOYSA-L Lithium carbonate Li2CO3 [Li+].[Li+].[O-]C([O-])=O lithium carbonate CO3.2Li carbonic acid, dilithium salt dilithium carbonate dilithium trioxidocarbonate |
|
definition |
A carbonate salt that has formula CO3.2Li. |
|
has role | ||
label |
lithium carbonate |
|
prefixIRI |
CHEBI:6504 |
|
prefLabel |
lithium carbonate |
|
subClassOf |
Create mapping