loading...| Preferred Name |
etoricoxib |
|
| Synonyms |
|
|
| Definitions |
A member of the class of bipyridines that is 2,3'-bipyridine which is substituted at the 3, 5, and 6' positions by 4-(methylsulfonyl)phenyl, chlorine, and methyl groups, respectively. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6339 |
|
| alternative term |
Etoricoxib 5-chloro-6'-methyl-3-(p-(methylsulfonyl)phenyl)-2,3'-bipyridine InChIKey=MNJVRJDLRVPLFE-UHFFFAOYSA-N Cc1ccc(cn1)-c1ncc(Cl)cc1-c1ccc(cc1)S(C)(=O)=O C18H15ClN2O2S 5-chloro-2-(6-methylpyridin-3-yl)-3-(4-(methylsulfonyl)phenyl)pyridine etoricoxib ETORICOXIB L791456 5-chloro-6'-methyl-3-[4-(methylsulfonyl)phenyl]-2,3'-bipyridine InChI=1S/C18H15ClN2O2S/c1-12-3-4-14(10-20-12)18-17(9-15(19)11-21-18)13-5-7-16(8-6-13)24(2,22)23/h3-11H,1-2H3 5-Chloro-3-(4-methanesulfonyl-phenyl)-6'-methyl-[2,3']bipyridinyl |
|
| definition |
A member of the class of bipyridines that is 2,3'-bipyridine which is substituted at the 3, 5, and 6' positions by 4-(methylsulfonyl)phenyl, chlorine, and methyl groups, respectively. |
|
| has role | ||
| label |
etoricoxib |
|
| prefixIRI |
CHEBI:6339 |
|
| prefLabel |
etoricoxib |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35850 |