loading...| Preferred Name |
ketamine |
|
| Synonyms |
|
|
| Definitions |
Cyclohexanone in which one of the hydrogens at position 2 is substituted by a 2-chlorophenyl group, while the other is substituted by a methylamino group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6121 |
|
| alternative term |
2-(2-chlorophenyl)-2-(methylamino)cyclohexanone (+-)-ketamine KETAMINE dl-ketamine CNC1(CCCCC1=O)c1ccccc1Cl cetamina ketamine 2-(o-chlorophenyl)-2-(methylamino)-cyclohexanone NMDA 2-(2-Chloro-phenyl)-2-methylamino-cyclohexanone ketaminum DL-ketamine special K InChIKey=YQEZLKZALYSWHR-UHFFFAOYSA-N InChI=1S/C13H16ClNO/c1-15-13(9-5-4-8-12(13)16)10-6-2-3-7-11(10)14/h2-3,6-7,15H,4-5,8-9H2,1H3 C13H16ClNO Ketamine 2-(methylamino)-2-(2-chlorophenyl)cyclohexanone |
|
| definition |
Cyclohexanone in which one of the hydrogens at position 2 is substituted by a 2-chlorophenyl group, while the other is substituted by a methylamino group. |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_60797 |
|
| label |
ketamine |
|
| prefixIRI |
CHEBI:6121 |
|
| prefLabel |
ketamine |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_50995 |