loading...| Preferred Name |
bortezomib |
|
| Synonyms |
|
|
| Definitions |
D-Phenylalaninamide substituted at the amide nitrogen by a 1-(dihydroxyboranyl)-3-methylbutyl group and at N(alpha) by a pyrazin-2-ylcarbonyl group. It is a dipeptidyl boronic acid that reversibly inhibits the 26S proteasome. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_52717 |
|
| alternative term |
CC(C)C[C@@H](NC(=O)[C@@H](Cc1ccccc1)NC(=O)c1cnccn1)B(O)O InChI=1S/C19H25BN4O4/c1-13(2)10-17(20(27)28)24-18(25)15(11-14-6-4-3-5-7-14)23-19(26)16-12-21-8-9-22-16/h3-9,12-13,15,17,27-28H,10-11H2,1-2H3,(H,23,26)(H,24,25)/t15-,17-/m1/s1 PS 341 Velcade bortezomib PS-341 [(1S)-3-methyl-1-({(2R)-3-phenyl-2-[(pyrazin-2-ylcarbonyl)amino]propanoyl}amino)butyl]boronic acid C19H25BN4O4 InChIKey=GXJABQQUPOEUTA-NVXWUHKLSA-N N-[(1S)-1-(dihydroxyboranyl)-3-methylbutyl]-N(alpha)-(pyrazin-2-ylcarbonyl)-D-phenylalaninamide |
|
| definition |
D-Phenylalaninamide substituted at the amide nitrogen by a 1-(dihydroxyboranyl)-3-methylbutyl group and at N(alpha) by a pyrazin-2-ylcarbonyl group. It is a dipeptidyl boronic acid that reversibly inhibits the 26S proteasome. |
|
| has functional parent | ||
| has role | ||
| label |
bortezomib |
|
| prefixIRI |
CHEBI:52717 |
|
| prefLabel |
bortezomib |
|
| subClassOf |