Preferred Name |
almotriptan |
|
Synonyms |
|
|
Definitions |
An indole compound having a 2-(dimethylamino)ethyl group at the 3-position and a (pyrrolidin-1-ylsulfonyl)methyl group at the 5-position. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_520985 |
|
alternative term |
1-(((3-(2-(Dimethylamino)ethyl)indol-5-yl)methyl)sulfonyl)pyrrolidine CN(C)CCc1c[nH]c2ccc(CS(=O)(=O)N3CCCC3)cc12 InChI=1S/C17H25N3O2S/c1-19(2)10-7-15-12-18-17-6-5-14(11-16(15)17)13-23(21,22)20-8-3-4-9-20/h5-6,11-12,18H,3-4,7-10,13H2,1-2H3 almotriptan N,N-dimethyl-2-{5-[(pyrrolidin-1-ylsulfonyl)methyl]-1H-indol-3-yl}ethanamine C17H25N3O2S InChIKey=WKEMJKQOLOHJLZ-UHFFFAOYSA-N |
|
definition |
An indole compound having a 2-(dimethylamino)ethyl group at the 3-position and a (pyrrolidin-1-ylsulfonyl)methyl group at the 5-position. |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_35941 |
|
label |
almotriptan |
|
prefixIRI |
CHEBI:520985 |
|
prefLabel |
almotriptan |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35358 |