Preferred Name |
flurbiprofen |
|
Synonyms |
|
|
Definitions |
A fluorobiphenyl that has formula C15H13FO2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_5130 |
|
alternative term |
InChI=1S/C15H13FO2/c1-10(15(17)18)12-7-8-13(14(16)9-12)11-5-3-2-4-6-11/h2-10H,1H3,(H,17,18) 2-fluoro-alpha-methyl-(1,1'-biphenyl)-4-acetic acid Flurbiprofen InChIKey=SYTBZMRGLBWNTM-UHFFFAOYSA-N 2-(2-fluorobiphenyl-4-yl)propanoic acid CC(C(O)=O)c1ccc(c(F)c1)-c1ccccc1 (+-)-2-fluoro-alpha-methyl-4-biphenylacetic acid Ansaid 3-fluoro-4-phenylhydratropic acid C15H13FO2 2-(2-fluoro-[1,1'-biphenyl-4-yl])propanoic acid |
|
definition |
A fluorobiphenyl that has formula C15H13FO2. |
|
has functional parent | ||
has parent hydride | ||
has role | ||
label |
flurbiprofen |
|
prefixIRI |
CHEBI:5130 |
|
prefLabel |
flurbiprofen |
|
subClassOf |
Create mapping