loading...| Preferred Name |
eletriptan |
|
| Synonyms |
|
|
| Definitions |
Eletriptan is an N-alkylpyrrolidine, being N-methylpyrrolidine in which the pro-R hydrogen at position 2 is substituted by a {5-[2-(phenylsulfonyl)ethyl]-1H-indol-3-yl}methyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_50922 |
|
| alternative term |
InChI=1S/C22H26N2O2S/c1-24-12-5-6-19(24)15-18-16-23-22-10-9-17(14-21(18)22)11-13-27(25,26)20-7-3-2-4-8-20/h2-4,7-10,14,16,19,23H,5-6,11-13,15H2,1H3/t19-/m1/s1 eletriptanum CN1CCC[C@@H]1Cc1c[nH]c2ccc(CCS(=O)(=O)c3ccccc3)cc12 C22H26N2O2S 3-{[(2R)-1-methylpyrrolidin-2-yl]methyl}-5-[2-(phenylsulfonyl)ethyl]-1H-indole eletriptan InChIKey=PWVXXGRKLHYWKM-LJQANCHMSA-N |
|
| definition |
Eletriptan is an N-alkylpyrrolidine, being N-methylpyrrolidine in which the pro-R hydrogen at position 2 is substituted by a {5-[2-(phenylsulfonyl)ethyl]-1H-indol-3-yl}methyl group. |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_35941 |
|
| is conjugate base of | ||
| label |
eletriptan |
|
| prefixIRI |
CHEBI:50922 |
|
| prefLabel |
eletriptan |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35850 |