loading...| Preferred Name |
fenoprofen |
|
| Synonyms |
|
|
| Definitions |
Propanoic acid in which one of the hydrogens at position 2 is substituted by a 3-phenoxyphenyl group. A non-steroidal anti-inflammatory drug, the dihydrate form of the calcium salt is used for the management of mild to moderate pain and for the relief of pain and inflammation associated with disorders such as arthritis. It is pharmacologically similar to aspirin, but causes less gastrointestinal bleeding. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_5004 |
|
| alternative term |
2-(m-phenoxyphenyl)propionic acid InChI=1S/C15H14O3/c1-11(15(16)17)12-6-5-9-14(10-12)18-13-7-3-2-4-8-13/h2-11H,1H3,(H,16,17) 2-(3-phenoxyphenyl)propionic acid CC(C(O)=O)c1cccc(Oc2ccccc2)c1 alpha-(m-phenoxyphenyl)propionic acid InChIKey=RDJGLLICXDHJDY-UHFFFAOYSA-N 2-(3-phenoxyphenyl)propanoic acid alpha-methyl-3-phenoxybenzeneacetic acid Fenoprofen (+-)-2-(3-phenoxyphenyl)propionic acid fenoprofen (+-)-m-phenoxyhydratropic acid fenoprofene FENOPROFEN fenoprofeno fenoprofenum C15H14O3 |
|
| definition |
Propanoic acid in which one of the hydrogens at position 2 is substituted by a 3-phenoxyphenyl group. A non-steroidal anti-inflammatory drug, the dihydrate form of the calcium salt is used for the management of mild to moderate pain and for the relief of pain and inflammation associated with disorders such as arthritis. It is pharmacologically similar to aspirin, but causes less gastrointestinal bleeding. |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_35493 http://purl.obolibrary.org/obo/CHEBI_50629 http://purl.obolibrary.org/obo/CHEBI_35475 |
|
| is conjugate acid of | ||
| label |
fenoprofen |
|
| prefixIRI |
CHEBI:5004 |
|
| prefLabel |
fenoprofen |
|
| subClassOf |