Preferred Name |
etomidate |
|
Synonyms |
|
|
Definitions |
The ethyl ester of 1-[(1R)-1-phenylethyl]-1H-imidazole-5-carboxylic acid. It is an intravenous general anaesthetic with no analgesic activity. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_4910 |
|
alternative term |
etomidatum InChIKey=NPUKDXXFDDZOKR-LLVKDONJSA-N etomidate Etomidate CCOC(=O)c1cncn1[C@H](C)c1ccccc1 (R)-1-(1-phenylethyl)-1H-imidazole-5-carboxylic acid ethyl ester etomidato 3-((R)-1-Phenyl-ethyl)-3H-imidazole-4-carboxylic acid ethyl ester (+)-etomidate (+)-ethyl 1-(alpha-methylbenzyl)imidazole-5-carboxylate R-(+)-ethyl 1-(1-phenylethyl)-1H-imidazole-5-carboxylate (R)-(+)-1-(alpha-methylbenzyl)imidazole-5-carboxylic acid ethyl ester InChI=1S/C14H16N2O2/c1-3-18-14(17)13-9-15-10-16(13)11(2)12-7-5-4-6-8-12/h4-11H,3H2,1-2H3/t11-/m1/s1 C14H16N2O2 ethyl 1-[(1R)-1-phenylethyl]-1H-imidazole-5-carboxylate |
|
definition |
The ethyl ester of 1-[(1R)-1-phenylethyl]-1H-imidazole-5-carboxylic acid. It is an intravenous general anaesthetic with no analgesic activity. |
|
has functional parent | ||
has role | ||
label |
etomidate |
|
prefixIRI |
CHEBI:4910 |
|
prefLabel |
etomidate |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_24780 |