Preferred Name |
enalapril |
|
Synonyms |
|
|
Definitions |
A dicarboxylic acid monoester that is ethyl 4-phenylbutanoate in which a hydrogen alpha to the carboxy group is substituted by the amino group of L-alanyl-L-proline (S-configuration). |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_4784 |
|
alternative term |
(S)-1-{(S)-2-[1-((S)-Ethoxycarbonyl)-3-phenyl-propylamino]-propionyl}-pyrrolidine-2-carboxylic acid enalapril InChIKey=GBXSMTUPTTWBMN-XIRDDKMYSA-N 1-(N-((S)-1-carboxy-3-phenylpropyl)-L-alanyl)-L-proline 1'-ethyl ester N-[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]-L-alanyl-L-proline CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N1CCC[C@H]1C(O)=O (S)-1-(N-(1-(ethoxycarbonyl)-3-phenylpropyl)-L-alanyl)-L-proline enalaprilum Enalapril enalaprila InChI=1S/C20H28N2O5/c1-3-27-20(26)16(12-11-15-8-5-4-6-9-15)21-14(2)18(23)22-13-7-10-17(22)19(24)25/h4-6,8-9,14,16-17,21H,3,7,10-13H2,1-2H3,(H,24,25)/t14-,16-,17-/m0/s1 ENALAPRIL |
|
definition |
A dicarboxylic acid monoester that is ethyl 4-phenylbutanoate in which a hydrogen alpha to the carboxy group is substituted by the amino group of L-alanyl-L-proline (S-configuration). |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_35674 |
|
label |
enalapril |
|
prefixIRI |
CHEBI:4784 |
|
prefLabel |
enalapril |
|
subClassOf |