Preferred Name |
vinyl acetate |
|
Synonyms |
|
|
Definitions |
An acetate ester that has formula C4H6O2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_46916 |
|
alternative term |
InChIKey=XTXRWKRVRITETP-UHFFFAOYSA-N Essigsaeurevinylester acetic acid vinyl ester vinyl ethanoate ethenyl acetate vinyl acetate acetoxyethene acetic acid ethenyl ester C4H6O2 ethenyl ethanoate InChI=1S/C4H6O2/c1-3-6-4(2)5/h3H,1H2,2H3 Vinylazetat Vinylacetat 1-acetoxyethylene CC(=O)OC=C |
|
definition |
An acetate ester that has formula C4H6O2. |
|
label |
vinyl acetate |
|
prefixIRI |
CHEBI:46916 |
|
prefLabel |
vinyl acetate |
|
subClassOf |
Create mapping