Preferred Name |
trimethoprim |
|
Synonyms |
|
|
Definitions |
An antibiotic whose structure consists of pyrimidine 2,4-diamine and 1,2,3-trimethoxybenzene moieties linked by a methylene bridge. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_45924 |
|
alternative term |
5-(3,4,5-trimethoxybenzyl)pyrimidine-2,4-diamine C14H18N4O3 InChI=1S/C14H18N4O3/c1-19-10-5-8(6-11(20-2)12(10)21-3)4-9-7-17-14(16)18-13(9)15/h5-7H,4H2,1-3H3,(H4,15,16,17,18) 2,4-diamino-5-(3,4,5-trimethoxybenzyl)pyrimidine TRIMETHOPRIM Trimpex COc1cc(Cc2cnc(N)nc2N)cc(OC)c1OC InChIKey=IEDVJHCEMCRBQM-UHFFFAOYSA-N 5-[(3,4,5-trimethoxyphenyl)methyl]-2,4-pyrimidinediamine Trimethoprim Proloprim |
|
definition |
An antibiotic whose structure consists of pyrimidine 2,4-diamine and 1,2,3-trimethoxybenzene moieties linked by a methylene bridge. |
|
has role | ||
label |
trimethoprim |
|
prefixIRI |
CHEBI:45924 |
|
prefLabel |
trimethoprim |
|
subClassOf |
Create mapping