loading...| Preferred Name |
propofol |
|
| Synonyms |
|
|
| Definitions |
A phenol resulting from the formal substitution of the hydrogen at the 2 position of 1,3-diisopropylbenzene by a hydroxy group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_44915 |
|
| alternative term |
InChI=1S/C12H18O/c1-8(2)10-6-5-7-11(9(3)4)12(10)13/h5-9,13H,1-4H3 Propofol propofolum Diprivan C12H18O InChIKey=OLBCVFGFOZPWHH-UHFFFAOYSA-N 2,6-Diisopropylphenol 2,6-BIS(1-METHYLETHYL)PHENOL Disoprivan Disoprofol 2,6-bis(1-methylethyl)phenol CC(C)c1cccc(C(C)C)c1O Rapinovet 2,6-bis(propan-2-yl)phenol propofol |
|
| definition |
A phenol resulting from the formal substitution of the hydrogen at the 2 position of 1,3-diisopropylbenzene by a hydroxy group. |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_38877 http://purl.obolibrary.org/obo/CHEBI_50919 http://purl.obolibrary.org/obo/CHEBI_35717 |
|
| label |
propofol |
|
| prefixIRI |
CHEBI:44915 |
|
| prefLabel |
propofol |
|
| subClassOf |