Jump to:
loading...| Preferred Name |
nimesulide |
|
| Synonyms |
|
|
| Definitions |
An aromatic ether having phenyl and 2-methylsulfonamido-5-nitrophenyl as the two aryl groups. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_44445 |
|
| alternative term |
C13H12N2O5S CS(=O)(=O)Nc1ccc(cc1Oc1ccccc1)[N+]([O-])=O InChIKey=HYWYRSMBCFDLJT-UHFFFAOYSA-N N-(4-nitro-2-phenoxyphenyl)methanesulfonamide InChI=1S/C13H12N2O5S/c1-21(18,19)14-12-8-7-10(15(16)17)9-13(12)20-11-5-3-2-4-6-11/h2-9,14H,1H3 Nimesulide 4'-nitro-2'-phenoxymethanesulfonanilide 4-NITRO-2-PHENOXYMETHANESULFONANILIDE |
|
| definition |
An aromatic ether having phenyl and 2-methylsulfonamido-5-nitrophenyl as the two aryl groups. |
|
| has functional parent | ||
| has role | ||
| label |
nimesulide |
|
| prefixIRI |
CHEBI:44445 |
|
| prefLabel |
nimesulide |
|
| subClassOf |
Create mapping