Preferred Name |
dantrolene |
|
Synonyms |
|
|
Definitions |
The hydrazone resulting from the formal condensation of 5-(4-nitrophenyl)furfural with 1-aminohydantoin. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_4317 |
|
alternative term |
1-({[5-(4-nitrophenyl)furan-2-yl]methylidene}amino)imidazolidine-2,4-dione 1-((5-(p-nitrophenyl)furfurylidene)amino)hydantoin dantrolene InChI=1S/C14H10N4O5/c19-13-8-17(14(20)16-13)15-7-11-5-6-12(23-11)9-1-3-10(4-2-9)18(21)22/h1-7H,8H2,(H,16,19,20) C14H10N4O5 Dantrolene [O-][N+](=O)c1ccc(cc1)-c1ccc(C=NN2CC(=O)NC2=O)o1 dantrolenum InChIKey=OZOMQRBLCMDCEG-UHFFFAOYSA-N dantroleno |
|
definition |
The hydrazone resulting from the formal condensation of 5-(4-nitrophenyl)furfural with 1-aminohydantoin. |
|
has role | ||
is conjugate acid of | ||
label |
dantrolene |
|
prefixIRI |
CHEBI:4317 |
|
prefLabel |
dantrolene |
|
subClassOf |
Create mapping