Preferred Name |
benzophenone |
|
Synonyms |
|
|
Definitions |
The simplest member of the class of benzophenones, being formaldehyde in which both hydrogens are replaced by phenyl groups. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_41308 |
|
alternative term |
benzophenone Benzophenone Diphenyl ketone Ph2CO O=C(c1ccccc1)c1ccccc1 alpha-oxodiphenylmethane InChIKey=RWCCWEUUXYIKHB-UHFFFAOYSA-N alpha-oxoditane benzoylbenzene InChI=1S/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H C13H10O DIPHENYLMETHANONE |
|
definition |
The simplest member of the class of benzophenones, being formaldehyde in which both hydrogens are replaced by phenyl groups. |
|
has role | ||
label |
benzophenone |
|
prefixIRI |
CHEBI:41308 |
|
prefLabel |
benzophenone |
|
subClassOf |
Create mapping