Preferred Name |
benzyl benzoate |
|
Synonyms |
|
|
Definitions |
A benzoate ester that has formula C14H12O2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_41237 |
|
alternative term |
BENZOIC ACID PHENYLMETHYLESTER InChIKey=SESFRYSPDFLNCH-UHFFFAOYSA-N benzyl benzoate O=C(OCc1ccccc1)c1ccccc1 benzoic acid, benzyl ester InChI=1S/C14H12O2/c15-14(13-9-5-2-6-10-13)16-11-12-7-3-1-4-8-12/h1-10H,11H2 benzoic acid, phenylmethyl ester phenylmethyl benzoate Benylate C14H12O2 |
|
definition |
A benzoate ester that has formula C14H12O2. |
|
has role | ||
label |
benzyl benzoate |
|
prefixIRI |
CHEBI:41237 |
|
prefLabel |
benzyl benzoate |
|
subClassOf |
Create mapping