Preferred Name |
9,10-anthraquinone |
|
Synonyms |
|
|
Definitions |
A tricyclic, aromatic compound derived from anthracene by the addition of two oxo- substituents at C-9 and C-10. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_40448 |
|
alternative term |
anthra-9,10-quinone 9,10-anthracenedione 9,10-anthraquinone 9,10-Anthracendion 9,10-quinone anthraquinone InChIKey=RZVHIXYEVGDQDX-UHFFFAOYSA-N InChI=1S/C14H8O2/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h1-8H C14H8O2 anthradione 9,10-Anthrachinon O=C1c2ccccc2C(=O)c2ccccc12 anthracene-9,10-dione Anthrachinon Az-Q 9,10-dioxoanthracene |
|
definition |
A tricyclic, aromatic compound derived from anthracene by the addition of two oxo- substituents at C-9 and C-10. |
|
label |
9,10-anthraquinone |
|
prefixIRI |
CHEBI:40448 |
|
prefLabel |
9,10-anthraquinone |
|
subClassOf |
Create mapping