Jump to:
loading...| Preferred Name |
clofibrate |
|
| Synonyms |
|
|
| Definitions |
A propanoate ester that has formula C12H15ClO3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3750 |
|
| alternative term |
Clofibrate C12H15ClO3 Ethyl 2-(p-chlorophenoxy)isobutyrate clofibrate alpha-p-Chlorophenoxyisobutyryl ethyl ester Liprin clofibrato Lipofacton Atromid-S InChIKey=KNHUKKLJHYUCFP-UHFFFAOYSA-N Ethyl chlorophenoxyisobutyrate ELPI 2-(p-Chlorophenoxy)-2-methylpropionic acid ethyl ester CCOC(=O)C(C)(C)Oc1ccc(Cl)cc1 ethyl 2-(4-chlorophenoxy)-2-methylpropanoate 2-(4-Chlorophenoxy)-2-methylpropanoic acid ethyl ester EPIB InChI=1S/C12H15ClO3/c1-4-15-11(14)12(2,3)16-10-7-5-9(13)6-8-10/h5-8H,4H2,1-3H3 clofibratum Ethyl clofibrate alpha-(p-Chlorophenoxy)isobutyric acid, ethyl ester |
|
| definition |
A propanoate ester that has formula C12H15ClO3. |
|
| has functional parent | ||
| has role | ||
| label |
clofibrate |
|
| prefixIRI |
CHEBI:3750 |
|
| prefLabel |
clofibrate |
|
| subClassOf |
Create mapping